C22H29O6P — CID 59071270
7-[[(7R,9R,10R)-10-methoxy-9-methyl-8-phosphanyloxy-6-oxaspiro[4.5]decan-7-yl]oxy]-4,8-dimethylchromen-2-one (PubChem CID 59071270) has the molecular formula C22H29O6P and a molecular weight of 420.44 g/mol. Its IUPAC name is 7-[[(7R,9R,10R)-10-methoxy-9-methyl-8-phosphanyloxy-6-oxaspiro[4.5]decan-7-yl]oxy]-4,8-dimethylchromen-2-one.
| Compound Name | 7-[[(7R,9R,10R)-10-methoxy-9-methyl-8-phosphanyloxy-6-oxaspiro[4.5]decan-7-yl]oxy]-4,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 59071270 |
| Molecular Formula | C22H29O6P |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 7-[[(7R,9R,10R)-10-methoxy-9-methyl-8-phosphanyloxy-6-oxaspiro[4.5]decan-7-yl]oxy]-4,8-dimethylchromen-2-one |
| SMILES | CO[C@@H]1[C@@H](C)C(OP)[C@H](Oc2ccc3c(C)cc(=O)oc3c2C)OC12CCCC2 |
| InChI | InChI=1S/C22H29O6P/c1-12-11-17(23)26-18-13(2)16(8-7-15(12)18)25-21-19(28-29)14(3)20(24-4)22(27-21)9-5-6-10-22/h7-8,11,14,19-21H,5-6,9-10,29H2,1-4H3/t14-,19?,20+,21+/m0/s1 |
| InChIKey | WSEZJWAHGWQTDB-QVDKGDQISA-N |
| XLogP | 4.28 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|