C20H22O8 — CID 59071269
7-[[(3aR,6S,7R,7aR)-6-ethyl-6,7-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-4-hydroxy-8-methylchromen-2-one (PubChem CID 59071269) has the molecular formula C20H22O8 and a molecular weight of 390.39 g/mol. Its IUPAC name is 7-[[(3aR,6S,7R,7aR)-6-ethyl-6,7-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-4-hydroxy-8-methylchromen-2-one.
| Compound Name | 7-[[(3aR,6S,7R,7aR)-6-ethyl-6,7-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-4-hydroxy-8-methylchromen-2-one |
|---|---|
| PubChem CID | 59071269 |
| Molecular Formula | C20H22O8 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 7-[[(3aR,6S,7R,7aR)-6-ethyl-6,7-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-4-hydroxy-8-methylchromen-2-one |
| SMILES | CC[C@]1(C)OC(Oc2ccc3c(O)cc(=O)oc3c2C)[C@@H]2OC(=O)O[C@@H]2[C@H]1C |
| InChI | InChI=1S/C20H22O8/c1-5-20(4)10(3)16-17(27-19(23)26-16)18(28-20)24-13-7-6-11-12(21)8-14(22)25-15(11)9(13)2/h6-8,10,16-18,21H,5H2,1-4H3/t10-,16-,17-,18?,20+/m1/s1 |
| InChIKey | KMSMQPHFCNNPJS-TXLCEPJISA-N |
| XLogP | 3.25 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|