C24H26O8 — CID 59071279
7-[[(3aR,6S,7R,7aR)-6,7-dimethyl-2-oxo-6-prop-2-enyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-4-hydroxy-8-methyl-3-prop-1-en-2-ylchromen-2-one (PubChem CID 59071279) has the molecular formula C24H26O8 and a molecular weight of 442.46 g/mol. Its IUPAC name is 7-[[(3aR,6S,7R,7aR)-6,7-dimethyl-2-oxo-6-prop-2-enyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-4-hydroxy-8-methyl-3-prop-1-en-2-ylchromen-2-one.
| Compound Name | 7-[[(3aR,6S,7R,7aR)-6,7-dimethyl-2-oxo-6-prop-2-enyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-4-hydroxy-8-methyl-3-prop-1-en-2-ylchromen-2-one |
|---|---|
| PubChem CID | 59071279 |
| Molecular Formula | C24H26O8 |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 7-[[(3aR,6S,7R,7aR)-6,7-dimethyl-2-oxo-6-prop-2-enyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-4-hydroxy-8-methyl-3-prop-1-en-2-ylchromen-2-one |
| SMILES | C=CC[C@]1(C)OC(Oc2ccc3c(O)c(C(=C)C)c(=O)oc3c2C)[C@@H]2OC(=O)O[C@@H]2[C@H]1C |
| InChI | InChI=1S/C24H26O8/c1-7-10-24(6)13(5)19-20(31-23(27)30-19)22(32-24)28-15-9-8-14-17(25)16(11(2)3)21(26)29-18(14)12(15)4/h7-9,13,19-20,22,25H,1-2,10H2,3-6H3/t13-,19-,20-,22?,24+/m1/s1 |
| InChIKey | DBAAXTOZENVKQL-GBZMWBKJSA-N |
| XLogP | 4.45 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|