C29H33NO12 — CID 158387393
[(3R,4S,5R,6R)-6-[3-[2-(2,6-dimethoxyphenyl)-2-oxoethyl]-4-hydroxy-8-methyl-2-oxochromen-7-yl]oxy-5-hydroxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate (PubChem CID 158387393) has the molecular formula C29H33NO12 and a molecular weight of 587.58 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-6-[3-[2-(2,6-dimethoxyphenyl)-2-oxoethyl]-4-hydroxy-8-methyl-2-oxochromen-7-yl]oxy-5-hydroxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate.
| Compound Name | [(3R,4S,5R,6R)-6-[3-[2-(2,6-dimethoxyphenyl)-2-oxoethyl]-4-hydroxy-8-methyl-2-oxochromen-7-yl]oxy-5-hydroxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate |
|---|---|
| PubChem CID | 158387393 |
| Molecular Formula | C29H33NO12 |
| Molecular Weight | 587.58 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | [(3R,4S,5R,6R)-6-[3-[2-(2,6-dimethoxyphenyl)-2-oxoethyl]-4-hydroxy-8-methyl-2-oxochromen-7-yl]oxy-5-hydroxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate |
| SMILES | COc1cccc(OC)c1C(=O)Cc1c(O)c2ccc(O[C@@H]3OC(C)(C)[C@H](OC)[C@@H](OC(N)=O)[C@H]3O)c(C)c2oc1=O |
| InChI | InChI=1S/C29H33NO12/c1-13-17(39-27-22(33)24(41-28(30)35)25(38-6)29(2,3)42-27)11-10-14-21(32)15(26(34)40-23(13)14)12-16(31)20-18(36-4)8-7-9-19(20)37-5/h7-11,22,24-25,27,32-33H,12H2,1-6H3,(H2,30,35)/t22-,24+,25-,27-/m1/s1 |
| InChIKey | FTSCOJJOJUYCFY-POHJQOBCSA-N |
| XLogP | 2.60 |
| TPSA | 186.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.58 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|