C33H33N3O11 — CID 160696300
[(3R,4S,5R,6R)-6-[3-[2-(4-diazenyl-3-phenoxyphenyl)-2-oxoethyl]-4-hydroxy-8-methyl-2-oxochromen-7-yl]oxy-5-hydroxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate (PubChem CID 160696300) has the molecular formula C33H33N3O11 and a molecular weight of 647.64 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-6-[3-[2-(4-diazenyl-3-phenoxyphenyl)-2-oxoethyl]-4-hydroxy-8-methyl-2-oxochromen-7-yl]oxy-5-hydroxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate.
| Compound Name | [(3R,4S,5R,6R)-6-[3-[2-(4-diazenyl-3-phenoxyphenyl)-2-oxoethyl]-4-hydroxy-8-methyl-2-oxochromen-7-yl]oxy-5-hydroxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate |
|---|---|
| PubChem CID | 160696300 |
| Molecular Formula | C33H33N3O11 |
| Molecular Weight | 647.64 g/mol |
| Exact Mass | 647.21 |
| IUPAC Name | [(3R,4S,5R,6R)-6-[3-[2-(4-diazenyl-3-phenoxyphenyl)-2-oxoethyl]-4-hydroxy-8-methyl-2-oxochromen-7-yl]oxy-5-hydroxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate |
| SMILES | [H]/N=N/c1ccc(C(=O)Cc2c(O)c3ccc(O[C@@H]4OC(C)(C)[C@H](OC)[C@@H](OC(N)=O)[C@H]4O)c(C)c3oc2=O)cc1Oc1ccccc1 |
| InChI | InChI=1S/C33H33N3O11/c1-16-23(44-31-26(39)28(46-32(34)41)29(42-4)33(2,3)47-31)13-11-19-25(38)20(30(40)45-27(16)19)15-22(37)17-10-12-21(36-35)24(14-17)43-18-8-6-5-7-9-18/h5-14,26,28-29,31,35,38-39H,15H2,1-4H3,(H2,34,41)/b36-35+/t26-,28+,29-,31-/m1/s1 |
| InChIKey | MBPCKOYASDAUKW-RNARHHIPSA-N |
| XLogP | 5.04 |
| TPSA | 213.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.64 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|