C34H41NO12 — CID 157359067
[(3R,4S,5R,6R)-5-hydroxy-6-[4-(2-hydroxyethoxy)-3-[2-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-2-oxoethyl]-8-methyl-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate (PubChem CID 157359067) has the molecular formula C34H41NO12 and a molecular weight of 655.70 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-5-hydroxy-6-[4-(2-hydroxyethoxy)-3-[2-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-2-oxoethyl]-8-methyl-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate.
| Compound Name | [(3R,4S,5R,6R)-5-hydroxy-6-[4-(2-hydroxyethoxy)-3-[2-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-2-oxoethyl]-8-methyl-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate |
|---|---|
| PubChem CID | 157359067 |
| Molecular Formula | C34H41NO12 |
| Molecular Weight | 655.70 g/mol |
| Exact Mass | 655.26 |
| IUPAC Name | [(3R,4S,5R,6R)-5-hydroxy-6-[4-(2-hydroxyethoxy)-3-[2-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-2-oxoethyl]-8-methyl-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate |
| SMILES | CO[C@@H]1[C@@H](OC(N)=O)[C@@H](O)[C@H](Oc2ccc3c(OCCO)c(CC(=O)c4ccc(O)c(CC=C(C)C)c4)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C34H41NO12/c1-17(2)7-8-19-15-20(9-11-23(19)37)24(38)16-22-28(43-14-13-36)21-10-12-25(18(3)27(21)45-31(22)40)44-32-26(39)29(46-33(35)41)30(42-6)34(4,5)47-32/h7,9-12,15,26,29-30,32,36-37,39H,8,13-14,16H2,1-6H3,(H2,35,41)/t26-,29+,30-,32-/m1/s1 |
| InChIKey | BIKRFRZKQMXEQL-KHHZTBOTSA-N |
| XLogP | 3.47 |
| TPSA | 197.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.70 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|