C32H35NO12 — CID 159276662
[(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-3-[2-[4-hydroxy-3-[(E)-4-oxopent-2-enyl]phenyl]-2-oxoethyl]-8-methyl-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate (PubChem CID 159276662) has the molecular formula C32H35NO12 and a molecular weight of 625.63 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-3-[2-[4-hydroxy-3-[(E)-4-oxopent-2-enyl]phenyl]-2-oxoethyl]-8-methyl-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate.
| Compound Name | [(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-3-[2-[4-hydroxy-3-[(E)-4-oxopent-2-enyl]phenyl]-2-oxoethyl]-8-methyl-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate |
|---|---|
| PubChem CID | 159276662 |
| Molecular Formula | C32H35NO12 |
| Molecular Weight | 625.63 g/mol |
| Exact Mass | 625.22 |
| IUPAC Name | [(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-3-[2-[4-hydroxy-3-[(E)-4-oxopent-2-enyl]phenyl]-2-oxoethyl]-8-methyl-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate |
| SMILES | CO[C@@H]1[C@@H](OC(N)=O)[C@@H](O)[C@H](Oc2ccc3c(O)c(CC(=O)c4ccc(O)c(C/C=C/C(C)=O)c4)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C32H35NO12/c1-15(34)7-6-8-17-13-18(9-11-21(17)35)22(36)14-20-24(37)19-10-12-23(16(2)26(19)43-29(20)39)42-30-25(38)27(44-31(33)40)28(41-5)32(3,4)45-30/h6-7,9-13,25,27-28,30,35,37-38H,8,14H2,1-5H3,(H2,33,40)/b7-6+/t25-,27+,28-,30-/m1/s1 |
| InChIKey | KYJVPEVTEXLCDQ-YEKFRUTGSA-N |
| XLogP | 2.98 |
| TPSA | 205.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.63 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|