C32H31N3O13 — CID 147778611
[(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-8-methyl-3-[(4-nitro-3-phenoxybenzoyl)amino]-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate (PubChem CID 147778611) has the molecular formula C32H31N3O13 and a molecular weight of 665.61 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-8-methyl-3-[(4-nitro-3-phenoxybenzoyl)amino]-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate.
| Compound Name | [(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-8-methyl-3-[(4-nitro-3-phenoxybenzoyl)amino]-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate |
|---|---|
| PubChem CID | 147778611 |
| Molecular Formula | C32H31N3O13 |
| Molecular Weight | 665.61 g/mol |
| Exact Mass | 665.19 |
| IUPAC Name | [(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-8-methyl-3-[(4-nitro-3-phenoxybenzoyl)amino]-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate |
| SMILES | CO[C@@H]1[C@@H](OC(N)=O)[C@@H](O)[C@H](Oc2ccc3c(O)c(NC(=O)c4ccc([N+](=O)[O-])c(Oc5ccccc5)c4)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C32H31N3O13/c1-15-20(45-30-24(37)26(47-31(33)40)27(43-4)32(2,3)48-30)13-11-18-23(36)22(29(39)46-25(15)18)34-28(38)16-10-12-19(35(41)42)21(14-16)44-17-8-6-5-7-9-17/h5-14,24,26-27,30,36-37H,1-4H3,(H2,33,40)(H,34,38)/t24-,26+,27-,30-/m1/s1 |
| InChIKey | HHILHKPDBBAKRT-PDYFWAJUSA-N |
| XLogP | 4.11 |
| TPSA | 232.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.61 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|