C32H33ClN2O11 — CID 139494427
N-[7-[(2R,3R,4S,5R)-4-[amino(hydroxy)methoxy]-3-hydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-4-hydroxy-8-methyl-2-oxochromen-3-yl]-3-(3-chlorophenoxy)benzamide (PubChem CID 139494427) has the molecular formula C32H33ClN2O11 and a molecular weight of 657.07 g/mol. Its IUPAC name is N-[7-[(2R,3R,4S,5R)-4-[amino(hydroxy)methoxy]-3-hydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-4-hydroxy-8-methyl-2-oxochromen-3-yl]-3-(3-chlorophenoxy)benzamide.
| Compound Name | N-[7-[(2R,3R,4S,5R)-4-[amino(hydroxy)methoxy]-3-hydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-4-hydroxy-8-methyl-2-oxochromen-3-yl]-3-(3-chlorophenoxy)benzamide |
|---|---|
| PubChem CID | 139494427 |
| Molecular Formula | C32H33ClN2O11 |
| Molecular Weight | 657.07 g/mol |
| Exact Mass | 656.18 |
| IUPAC Name | N-[7-[(2R,3R,4S,5R)-4-[amino(hydroxy)methoxy]-3-hydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-4-hydroxy-8-methyl-2-oxochromen-3-yl]-3-(3-chlorophenoxy)benzamide |
| SMILES | CO[C@@H]1[C@@H](OC(N)O)[C@@H](O)[C@H](Oc2ccc3c(O)c(NC(=O)c4cccc(Oc5cccc(Cl)c5)c4)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C32H33ClN2O11/c1-15-21(43-30-24(37)26(45-31(34)40)27(41-4)32(2,3)46-30)12-11-20-23(36)22(29(39)44-25(15)20)35-28(38)16-7-5-9-18(13-16)42-19-10-6-8-17(33)14-19/h5-14,24,26-27,30-31,36-37,40H,34H2,1-4H3,(H,35,38)/t24-,26+,27-,30-,31?/m1/s1 |
| InChIKey | YOTVNGKVBYEXBR-MZOGAECZSA-N |
| XLogP | 4.01 |
| TPSA | 192.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.07 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|