C26H27F5N2O10S — CID 139494495
[(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-8-methyl-2-oxo-3-[[3-(pentafluoro-λ6-sulfanyl)benzoyl]amino]chromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate (PubChem CID 139494495) has the molecular formula C26H27F5N2O10S and a molecular weight of 654.56 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-8-methyl-2-oxo-3-[[3-(pentafluoro-λ6-sulfanyl)benzoyl]amino]chromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate.
| Compound Name | [(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-8-methyl-2-oxo-3-[[3-(pentafluoro-λ6-sulfanyl)benzoyl]amino]chromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate |
|---|---|
| PubChem CID | 139494495 |
| Molecular Formula | C26H27F5N2O10S |
| Molecular Weight | 654.56 g/mol |
| Exact Mass | 654.13 |
| IUPAC Name | [(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-8-methyl-2-oxo-3-[[3-(pentafluoro-λ6-sulfanyl)benzoyl]amino]chromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate |
| SMILES | CO[C@@H]1[C@@H](OC(N)=O)[C@@H](O)[C@H](Oc2ccc3c(O)c(NC(=O)c4cccc(S(F)(F)(F)(F)F)c4)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C26H27F5N2O10S/c1-11-15(40-24-18(35)20(42-25(32)38)21(39-4)26(2,3)43-24)9-8-14-17(34)16(23(37)41-19(11)14)33-22(36)12-6-5-7-13(10-12)44(27,28,29,30)31/h5-10,18,20-21,24,34-35H,1-4H3,(H2,32,38)(H,33,36)/t18-,20+,21-,24-/m1/s1 |
| InChIKey | KJJGSPDUWWHHTN-LOCCHRAXSA-N |
| XLogP | 5.07 |
| TPSA | 179.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|