C25H29N3O10 — CID 71770671
[(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-8-methyl-3-[(5-methyl-1H-pyrrole-2-carbonyl)amino]-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate (PubChem CID 71770671) has the molecular formula C25H29N3O10 and a molecular weight of 531.52 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-8-methyl-3-[(5-methyl-1H-pyrrole-2-carbonyl)amino]-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate.
| Compound Name | [(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-8-methyl-3-[(5-methyl-1H-pyrrole-2-carbonyl)amino]-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate |
|---|---|
| PubChem CID | 71770671 |
| Molecular Formula | C25H29N3O10 |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | [(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-8-methyl-3-[(5-methyl-1H-pyrrole-2-carbonyl)amino]-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate |
| SMILES | CO[C@@H]1[C@@H](OC(N)=O)[C@@H](O)[C@H](Oc2ccc3c(O)c(NC(=O)c4ccc(C)[nH]4)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C25H29N3O10/c1-10-6-8-13(27-10)21(31)28-15-16(29)12-7-9-14(11(2)18(12)36-22(15)32)35-23-17(30)19(37-24(26)33)20(34-5)25(3,4)38-23/h6-9,17,19-20,23,27,29-30H,1-5H3,(H2,26,33)(H,28,31)/t17-,19+,20-,23-/m1/s1 |
| InChIKey | WDONKPKXGIVTJT-RKCFAAOBSA-N |
| XLogP | 2.05 |
| TPSA | 195.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|