C31H33N3O10 — CID 172565861
[(3R,4S,5R,6R)-6-[3-[(4-aminobenzoyl)amino]-4-hydroxy-8-methyl-2-oxochromen-7-yl]oxy-5-hydroxy-3-methoxy-2,2-dimethyloxan-4-yl] 5-methyl-1H-pyrrole-2-carboxylate (PubChem CID 172565861) has the molecular formula C31H33N3O10 and a molecular weight of 607.62 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-6-[3-[(4-aminobenzoyl)amino]-4-hydroxy-8-methyl-2-oxochromen-7-yl]oxy-5-hydroxy-3-methoxy-2,2-dimethyloxan-4-yl] 5-methyl-1H-pyrrole-2-carboxylate.
| Compound Name | [(3R,4S,5R,6R)-6-[3-[(4-aminobenzoyl)amino]-4-hydroxy-8-methyl-2-oxochromen-7-yl]oxy-5-hydroxy-3-methoxy-2,2-dimethyloxan-4-yl] 5-methyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 172565861 |
| Molecular Formula | C31H33N3O10 |
| Molecular Weight | 607.62 g/mol |
| Exact Mass | 607.22 |
| IUPAC Name | [(3R,4S,5R,6R)-6-[3-[(4-aminobenzoyl)amino]-4-hydroxy-8-methyl-2-oxochromen-7-yl]oxy-5-hydroxy-3-methoxy-2,2-dimethyloxan-4-yl] 5-methyl-1H-pyrrole-2-carboxylate |
| SMILES | CO[C@@H]1[C@@H](OC(=O)c2ccc(C)[nH]2)[C@@H](O)[C@H](Oc2ccc3c(O)c(NC(=O)c4ccc(N)cc4)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C31H33N3O10/c1-14-6-12-19(33-14)28(38)43-25-23(36)30(44-31(3,4)26(25)40-5)41-20-13-11-18-22(35)21(29(39)42-24(18)15(20)2)34-27(37)16-7-9-17(32)10-8-16/h6-13,23,25-26,30,33,35-36H,32H2,1-5H3,(H,34,37)/t23-,25+,26-,30-/m1/s1 |
| InChIKey | DCSDJTRUKQRAQZ-CPPKFOPJSA-N |
| XLogP | 3.39 |
| TPSA | 195.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.62 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|