C27H34Cl2N2O11 — CID 57342431
[(2R,3R,4R,5R)-4-carbamoyloxy-2-[3-(4-chlorobutanoylamino)-4-hydroxy-8-methyl-2-oxochromen-7-yl]oxy-5-methoxy-6,6-dimethyloxan-3-yl] 4-chlorobutanoate (PubChem CID 57342431) has the molecular formula C27H34Cl2N2O11 and a molecular weight of 633.48 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-carbamoyloxy-2-[3-(4-chlorobutanoylamino)-4-hydroxy-8-methyl-2-oxochromen-7-yl]oxy-5-methoxy-6,6-dimethyloxan-3-yl] 4-chlorobutanoate.
| Compound Name | [(2R,3R,4R,5R)-4-carbamoyloxy-2-[3-(4-chlorobutanoylamino)-4-hydroxy-8-methyl-2-oxochromen-7-yl]oxy-5-methoxy-6,6-dimethyloxan-3-yl] 4-chlorobutanoate |
|---|---|
| PubChem CID | 57342431 |
| Molecular Formula | C27H34Cl2N2O11 |
| Molecular Weight | 633.48 g/mol |
| Exact Mass | 632.15 |
| IUPAC Name | [(2R,3R,4R,5R)-4-carbamoyloxy-2-[3-(4-chlorobutanoylamino)-4-hydroxy-8-methyl-2-oxochromen-7-yl]oxy-5-methoxy-6,6-dimethyloxan-3-yl] 4-chlorobutanoate |
| SMILES | COC1[C@@H](OC(N)=O)[C@@H](OC(=O)CCCCl)[C@H](Oc2ccc3c(O)c(NC(=O)CCCCl)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C27H34Cl2N2O11/c1-13-15(10-9-14-19(34)18(24(35)40-20(13)14)31-16(32)7-5-11-28)38-25-22(39-17(33)8-6-12-29)21(41-26(30)36)23(37-4)27(2,3)42-25/h9-10,21-23,25,34H,5-8,11-12H2,1-4H3,(H2,30,36)(H,31,32)/t21-,22+,23?,25+/m0/s1 |
| InChIKey | SUUNZOASKCKJMW-AIZWBZKKSA-N |
| XLogP | 3.69 |
| TPSA | 185.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|