C20H25NO8 — CID 159728011
[(3R,4S,6S)-5-hydroxy-6-(4-hydroxy-3,8-dimethyl-2-oxochromen-7-yl)oxy-2,2,3-trimethyloxan-4-yl] carbamate (PubChem CID 159728011) has the molecular formula C20H25NO8 and a molecular weight of 407.42 g/mol. Its IUPAC name is [(3R,4S,6S)-5-hydroxy-6-(4-hydroxy-3,8-dimethyl-2-oxochromen-7-yl)oxy-2,2,3-trimethyloxan-4-yl] carbamate.
| Compound Name | [(3R,4S,6S)-5-hydroxy-6-(4-hydroxy-3,8-dimethyl-2-oxochromen-7-yl)oxy-2,2,3-trimethyloxan-4-yl] carbamate |
|---|---|
| PubChem CID | 159728011 |
| Molecular Formula | C20H25NO8 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | [(3R,4S,6S)-5-hydroxy-6-(4-hydroxy-3,8-dimethyl-2-oxochromen-7-yl)oxy-2,2,3-trimethyloxan-4-yl] carbamate |
| SMILES | Cc1c(O)c2ccc(O[C@@H]3OC(C)(C)[C@H](C)[C@H](OC(N)=O)C3O)c(C)c2oc1=O |
| InChI | InChI=1S/C20H25NO8/c1-8-12(7-6-11-13(22)9(2)17(24)27-15(8)11)26-18-14(23)16(28-19(21)25)10(3)20(4,5)29-18/h6-7,10,14,16,18,22-23H,1-5H3,(H2,21,25)/t10-,14?,16+,18-/m1/s1 |
| InChIKey | NAWLRZGBHVFNRP-QJABBFIISA-N |
| XLogP | 2.09 |
| TPSA | 141.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|