C21H25NO6 — CID 131723121
3-(N-methoxy-C-methylcarbonimidoyl)-8-methyl-7-(oxan-2-yloxy)-4-prop-2-enoxychromen-2-one (PubChem CID 131723121) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is 3-(N-methoxy-C-methylcarbonimidoyl)-8-methyl-7-(oxan-2-yloxy)-4-prop-2-enoxychromen-2-one.
| Compound Name | 3-(N-methoxy-C-methylcarbonimidoyl)-8-methyl-7-(oxan-2-yloxy)-4-prop-2-enoxychromen-2-one |
|---|---|
| PubChem CID | 131723121 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 3-(N-methoxy-C-methylcarbonimidoyl)-8-methyl-7-(oxan-2-yloxy)-4-prop-2-enoxychromen-2-one |
| SMILES | C=CCOc1c(C(C)=NOC)c(=O)oc2c(C)c(OC3CCCCO3)ccc12 |
| InChI | InChI=1S/C21H25NO6/c1-5-11-26-20-15-9-10-16(27-17-8-6-7-12-25-17)13(2)19(15)28-21(23)18(20)14(3)22-24-4/h5,9-10,17H,1,6-8,11-12H2,2-4H3 |
| InChIKey | LILWUEWCNRONEM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 79.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|