C20H18O5 — CID 86651374
8-hydroxy-7-(oxan-2-yloxy)-4-phenylchromen-2-one (PubChem CID 86651374) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is 8-hydroxy-7-(oxan-2-yloxy)-4-phenylchromen-2-one.
| Compound Name | 8-hydroxy-7-(oxan-2-yloxy)-4-phenylchromen-2-one |
|---|---|
| PubChem CID | 86651374 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 8-hydroxy-7-(oxan-2-yloxy)-4-phenylchromen-2-one |
| SMILES | O=c1cc(-c2ccccc2)c2ccc(OC3CCCCO3)c(O)c2o1 |
| InChI | InChI=1S/C20H18O5/c21-17-12-15(13-6-2-1-3-7-13)14-9-10-16(19(22)20(14)25-17)24-18-8-4-5-11-23-18/h1-3,6-7,9-10,12,18,22H,4-5,8,11H2 |
| InChIKey | KZFJKJMXIXNOPT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|