C16H18O5 — CID 22026149
6,7-dimethyl-5-(oxan-2-yloxy)-1-benzofuran-2-carboxylic acid (PubChem CID 22026149) has the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. Its IUPAC name is 6,7-dimethyl-5-(oxan-2-yloxy)-1-benzofuran-2-carboxylic acid.
| Compound Name | 6,7-dimethyl-5-(oxan-2-yloxy)-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 22026149 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 6,7-dimethyl-5-(oxan-2-yloxy)-1-benzofuran-2-carboxylic acid |
| SMILES | Cc1c(OC2CCCCO2)cc2cc(C(=O)O)oc2c1C |
| InChI | InChI=1S/C16H18O5/c1-9-10(2)15-11(8-13(21-15)16(17)18)7-12(9)20-14-5-3-4-6-19-14/h7-8,14H,3-6H2,1-2H3,(H,17,18) |
| InChIKey | QNHQGQNIGYKASG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |