C16H24B2O8 — CID 25242206
[4-borono-2,5-bis(oxan-2-yloxy)phenyl]boronic acid (PubChem CID 25242206) has the molecular formula C16H24B2O8 and a molecular weight of 365.98 g/mol. Its IUPAC name is [4-borono-2,5-bis(oxan-2-yloxy)phenyl]boronic acid.
| Compound Name | [4-borono-2,5-bis(oxan-2-yloxy)phenyl]boronic acid |
|---|---|
| PubChem CID | 25242206 |
| Molecular Formula | C16H24B2O8 |
| Molecular Weight | 365.98 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | [4-borono-2,5-bis(oxan-2-yloxy)phenyl]boronic acid |
| SMILES | OB(O)c1cc(OC2CCCCO2)c(B(O)O)cc1OC1CCCCO1 |
| InChI | InChI=1S/C16H24B2O8/c19-17(20)11-10-14(26-16-6-2-4-8-24-16)12(18(21)22)9-13(11)25-15-5-1-3-7-23-15/h9-10,15-16,19-22H,1-8H2 |
| InChIKey | CJEGSBVJYRRNNK-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.98 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|