C17H29BO7 — CID 175556774
2,3-dimethylbutane-2,3-diol;[4-(oxan-2-yloxy)phenoxy]boronic acid (PubChem CID 175556774) has the molecular formula C17H29BO7 and a molecular weight of 356.22 g/mol. Its IUPAC name is 2,3-dimethylbutane-2,3-diol;[4-(oxan-2-yloxy)phenoxy]boronic acid.
| Compound Name | 2,3-dimethylbutane-2,3-diol;[4-(oxan-2-yloxy)phenoxy]boronic acid |
|---|---|
| PubChem CID | 175556774 |
| Molecular Formula | C17H29BO7 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 2,3-dimethylbutane-2,3-diol;[4-(oxan-2-yloxy)phenoxy]boronic acid |
| SMILES | CC(C)(O)C(C)(C)O.OB(O)Oc1ccc(OC2CCCCO2)cc1 |
| InChI | InChI=1S/C11H15BO5.C6H14O2/c13-12(14)17-10-6-4-9(5-7-10)16-11-3-1-2-8-15-11;1-5(2,7)6(3,4)8/h4-7,11,13-14H,1-3,8H2;7-8H,1-4H3 |
| InChIKey | MRZDIJBFEDYHHN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|