About 2-(4-bromophenoxy)oxane;trimethyl-[4-(oxan-2-yloxy)phenyl]silane
2-(4-bromophenoxy)oxane;trimethyl-[4-(oxan-2-yloxy)phenyl]silane (PubChem CID 159621581) has the molecular formula C25H35BrO4Si
and a molecular weight of 507.54 g/mol. Its IUPAC name is 2-(4-bromophenoxy)oxane;trimethyl-[4-(oxan-2-yloxy)phenyl]silane.
Molecular Properties
| Compound Name | 2-(4-bromophenoxy)oxane;trimethyl-[4-(oxan-2-yloxy)phenyl]silane |
| PubChem CID | 159621581 |
| Molecular Formula | C25H35BrO4Si |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | 2-(4-bromophenoxy)oxane;trimethyl-[4-(oxan-2-yloxy)phenyl]silane |
| SMILES | Brc1ccc(OC2CCCCO2)cc1.C[Si](C)(C)c1ccc(OC2CCCCO2)cc1 |
| InChI | InChI=1S/C14H22O2Si.C11H13BrO2/c1-17(2,3)13-9-7-12(8-10-13)16-14-6-4-5-11-15-14;12-9-4-6-10(7-5-9)14-11-3-1-2-8-13-11/h7-10,14H,4-6,11H2,1-3H3;4-7,11H,1-3,8H2 |
| InChIKey | MNYNDTADGIBIHJ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromophenoxy)oxane;trimethyl-[4-(oxan-2-yloxy)phenyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenoxy)oxane;trimethyl-[4-(oxan-2-yloxy)phenyl]silane?
The IUPAC name of 2-(4-bromophenoxy)oxane;trimethyl-[4-(oxan-2-yloxy)phenyl]silane (CID 159621581) is 2-(4-bromophenoxy)oxane;trimethyl-[4-(oxan-2-yloxy)phenyl]silane.
What is the SMILES notation for 2-(4-bromophenoxy)oxane;trimethyl-[4-(oxan-2-yloxy)phenyl]silane?
The canonical SMILES for 2-(4-bromophenoxy)oxane;trimethyl-[4-(oxan-2-yloxy)phenyl]silane is Brc1ccc(OC2CCCCO2)cc1.C[Si](C)(C)c1ccc(OC2CCCCO2)cc1.
What is the InChIKey of 2-(4-bromophenoxy)oxane;trimethyl-[4-(oxan-2-yloxy)phenyl]silane?
The InChIKey is MNYNDTADGIBIHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2Si.C11H13BrO2/c1-17(2,3)13-9-7-12(8-10-13)16-14-6-4-5-11-15-14;12-9-4-6-10(7-5-9)14-11-3-1-2-8-13-11/h7-10,14H,4-6,11H2,1-3H3;4-7,11H,1-3,8H2.
What are the key properties of 2-(4-bromophenoxy)oxane;trimethyl-[4-(oxan-2-yloxy)phenyl]silane?
2-(4-bromophenoxy)oxane;trimethyl-[4-(oxan-2-yloxy)phenyl]silane has a molecular weight of 507.54 g/mol, XLogP of 6.49, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenoxy)oxane;trimethyl-[4-(oxan-2-yloxy)phenyl]silane is sourced from PubChem (CID 159621581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).