About 2-(3-bromophenoxy)oxane
2-(3-bromophenoxy)oxane (PubChem CID 5067264) has the molecular formula C11H13BrO2
and a molecular weight of 257.13 g/mol. Its IUPAC name is 2-(3-bromophenoxy)oxane.
Molecular Properties
| Compound Name | 2-(3-bromophenoxy)oxane |
| PubChem CID | 5067264 |
| Molecular Formula | C11H13BrO2 |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 2-(3-bromophenoxy)oxane |
| SMILES | Brc1cccc(OC2CCCCO2)c1 |
| InChI | InChI=1S/C11H13BrO2/c12-9-4-3-5-10(8-9)14-11-6-1-2-7-13-11/h3-5,8,11H,1-2,6-7H2 |
| InChIKey | YDIPSMGGPVMCHP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-bromophenoxy)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromophenoxy)oxane?
The IUPAC name of 2-(3-bromophenoxy)oxane (CID 5067264) is 2-(3-bromophenoxy)oxane.
What is the SMILES notation for 2-(3-bromophenoxy)oxane?
The canonical SMILES for 2-(3-bromophenoxy)oxane is Brc1cccc(OC2CCCCO2)c1.
What is the InChIKey of 2-(3-bromophenoxy)oxane?
The InChIKey is YDIPSMGGPVMCHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrO2/c12-9-4-3-5-10(8-9)14-11-6-1-2-7-13-11/h3-5,8,11H,1-2,6-7H2.
What are the key properties of 2-(3-bromophenoxy)oxane?
2-(3-bromophenoxy)oxane has a molecular weight of 257.13 g/mol, XLogP of 3.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromophenoxy)oxane is sourced from PubChem (CID 5067264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).