C22H24N2O4 — CID 124863691
3,8-bis[[(2R)-oxan-2-yl]oxy]benzo[c]cinnoline (PubChem CID 124863691) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 3,8-bis[[(2R)-oxan-2-yl]oxy]benzo[c]cinnoline.
| Compound Name | 3,8-bis[[(2R)-oxan-2-yl]oxy]benzo[c]cinnoline |
|---|---|
| PubChem CID | 124863691 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 3,8-bis[[(2R)-oxan-2-yl]oxy]benzo[c]cinnoline |
| SMILES | c1cc2c(cc1O[C@@H]1CCCCO1)nnc1cc(O[C@@H]3CCCCO3)ccc12 |
| InChI | InChI=1S/C22H24N2O4/c1-3-11-25-21(5-1)27-15-7-9-17-18-10-8-16(28-22-6-2-4-12-26-22)14-20(18)24-23-19(17)13-15/h7-10,13-14,21-22H,1-6,11-12H2/t21-,22-/m1/s1 |
| InChIKey | UCJCXWLJKXAHSH-FGZHOGPDSA-N |
| XLogP | 4.59 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|