C13H18O2 — CID 10987441
2-(3,4-dimethylphenoxy)oxane (PubChem CID 10987441) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)oxane.
| Compound Name | 2-(3,4-dimethylphenoxy)oxane |
|---|---|
| PubChem CID | 10987441 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)oxane |
| SMILES | Cc1ccc(OC2CCCCO2)cc1C |
| InChI | InChI=1S/C13H18O2/c1-10-6-7-12(9-11(10)2)15-13-5-3-4-8-14-13/h6-7,9,13H,3-5,8H2,1-2H3 |
| InChIKey | LWAUMDXZTNIXJT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |