C24H28O5 — CID 154680130
9-methyl-2,7-bis(oxan-2-yloxy)fluoren-9-ol (PubChem CID 154680130) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is 9-methyl-2,7-bis(oxan-2-yloxy)fluoren-9-ol.
| Compound Name | 9-methyl-2,7-bis(oxan-2-yloxy)fluoren-9-ol |
|---|---|
| PubChem CID | 154680130 |
| Molecular Formula | C24H28O5 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 9-methyl-2,7-bis(oxan-2-yloxy)fluoren-9-ol |
| SMILES | CC1(O)c2cc(OC3CCCCO3)ccc2-c2ccc(OC3CCCCO3)cc21 |
| InChI | InChI=1S/C24H28O5/c1-24(25)20-14-16(28-22-6-2-4-12-26-22)8-10-18(20)19-11-9-17(15-21(19)24)29-23-7-3-5-13-27-23/h8-11,14-15,22-23,25H,2-7,12-13H2,1H3 |
| InChIKey | JZZUXVJIAANIFC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |