C30H34O5 — CID 170406702
4-[1,1-bis[4-(oxan-2-yloxy)phenyl]ethyl]phenol (PubChem CID 170406702) has the molecular formula C30H34O5 and a molecular weight of 474.60 g/mol. Its IUPAC name is 4-[1,1-bis[4-(oxan-2-yloxy)phenyl]ethyl]phenol.
| Compound Name | 4-[1,1-bis[4-(oxan-2-yloxy)phenyl]ethyl]phenol |
|---|---|
| PubChem CID | 170406702 |
| Molecular Formula | C30H34O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 4-[1,1-bis[4-(oxan-2-yloxy)phenyl]ethyl]phenol |
| SMILES | CC(c1ccc(O)cc1)(c1ccc(OC2CCCCO2)cc1)c1ccc(OC2CCCCO2)cc1 |
| InChI | InChI=1S/C30H34O5/c1-30(22-8-14-25(31)15-9-22,23-10-16-26(17-11-23)34-28-6-2-4-20-32-28)24-12-18-27(19-13-24)35-29-7-3-5-21-33-29/h8-19,28-29,31H,2-7,20-21H2,1H3 |
| InChIKey | WWNZPLQOFPCZAP-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|