C21H24O4 — CID 70479359
2-[4-[2-[4-(oxetan-2-yloxy)phenyl]propan-2-yl]phenoxy]oxetane (PubChem CID 70479359) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-[4-[2-[4-(oxetan-2-yloxy)phenyl]propan-2-yl]phenoxy]oxetane.
| Compound Name | 2-[4-[2-[4-(oxetan-2-yloxy)phenyl]propan-2-yl]phenoxy]oxetane |
|---|---|
| PubChem CID | 70479359 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 2-[4-[2-[4-(oxetan-2-yloxy)phenyl]propan-2-yl]phenoxy]oxetane |
| SMILES | CC(C)(c1ccc(OC2CCO2)cc1)c1ccc(OC2CCO2)cc1 |
| InChI | InChI=1S/C21H24O4/c1-21(2,15-3-7-17(8-4-15)24-19-11-13-22-19)16-5-9-18(10-6-16)25-20-12-14-23-20/h3-10,19-20H,11-14H2,1-2H3 |
| InChIKey | HYTONQMKLLRQNW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |