C21H26O4 — CID 21335752
1-[4-[2-[4-(oxiran-2-yloxy)phenyl]propan-2-yl]phenoxy]butan-2-ol (PubChem CID 21335752) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-[4-[2-[4-(oxiran-2-yloxy)phenyl]propan-2-yl]phenoxy]butan-2-ol.
| Compound Name | 1-[4-[2-[4-(oxiran-2-yloxy)phenyl]propan-2-yl]phenoxy]butan-2-ol |
|---|---|
| PubChem CID | 21335752 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 1-[4-[2-[4-(oxiran-2-yloxy)phenyl]propan-2-yl]phenoxy]butan-2-ol |
| SMILES | CCC(O)COc1ccc(C(C)(C)c2ccc(OC3CO3)cc2)cc1 |
| InChI | InChI=1S/C21H26O4/c1-4-17(22)13-23-18-9-5-15(6-10-18)21(2,3)16-7-11-19(12-8-16)25-20-14-24-20/h5-12,17,20,22H,4,13-14H2,1-3H3 |
| InChIKey | IAQPJQDRFZJHSE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|