C22H28O3S — CID 22975905
1-[4-[2-[4-(thiiran-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]butan-2-ol (PubChem CID 22975905) has the molecular formula C22H28O3S and a molecular weight of 372.53 g/mol. Its IUPAC name is 1-[4-[2-[4-(thiiran-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]butan-2-ol.
| Compound Name | 1-[4-[2-[4-(thiiran-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]butan-2-ol |
|---|---|
| PubChem CID | 22975905 |
| Molecular Formula | C22H28O3S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1-[4-[2-[4-(thiiran-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]butan-2-ol |
| SMILES | CCC(O)COc1ccc(C(C)(C)c2ccc(OCC3CS3)cc2)cc1 |
| InChI | InChI=1S/C22H28O3S/c1-4-18(23)13-24-19-9-5-16(6-10-19)22(2,3)17-7-11-20(12-8-17)25-14-21-15-26-21/h5-12,18,21,23H,4,13-15H2,1-3H3 |
| InChIKey | RMAYRQGERYDPNF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|