C36H45BO6 — CID 59724363
2-[4-[1,1-bis[4-(oxan-2-yloxy)phenyl]ethyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 59724363) has the molecular formula C36H45BO6 and a molecular weight of 584.56 g/mol. Its IUPAC name is 2-[4-[1,1-bis[4-(oxan-2-yloxy)phenyl]ethyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-[1,1-bis[4-(oxan-2-yloxy)phenyl]ethyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 59724363 |
| Molecular Formula | C36H45BO6 |
| Molecular Weight | 584.56 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | 2-[4-[1,1-bis[4-(oxan-2-yloxy)phenyl]ethyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(c1ccc(OC2CCCCO2)cc1)(c1ccc(OC2CCCCO2)cc1)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C36H45BO6/c1-34(2)35(3,4)43-37(42-34)29-18-12-26(13-19-29)36(5,27-14-20-30(21-15-27)40-32-10-6-8-24-38-32)28-16-22-31(23-17-28)41-33-11-7-9-25-39-33/h12-23,32-33H,6-11,24-25H2,1-5H3 |
| InChIKey | AFTWCCXUOYNTPT-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.56 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|