C16H22O2S2 — CID 10267421
2-[4-(2-methyl-1,3-dithian-2-yl)phenoxy]oxane (PubChem CID 10267421) has the molecular formula C16H22O2S2 and a molecular weight of 310.48 g/mol. Its IUPAC name is 2-[4-(2-methyl-1,3-dithian-2-yl)phenoxy]oxane.
| Compound Name | 2-[4-(2-methyl-1,3-dithian-2-yl)phenoxy]oxane |
|---|---|
| PubChem CID | 10267421 |
| Molecular Formula | C16H22O2S2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-[4-(2-methyl-1,3-dithian-2-yl)phenoxy]oxane |
| SMILES | CC1(c2ccc(OC3CCCCO3)cc2)SCCCS1 |
| InChI | InChI=1S/C16H22O2S2/c1-16(19-11-4-12-20-16)13-6-8-14(9-7-13)18-15-5-2-3-10-17-15/h6-9,15H,2-5,10-12H2,1H3 |
| InChIKey | UATZKEWMNNGNQY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |