C24H37BO5 — CID 125496612
4,4,5,5-tetramethyl-2-[4-[[4-[(2R)-oxan-2-yl]oxycyclohexyl]methoxy]phenyl]-1,3,2-dioxaborolane (PubChem CID 125496612) has the molecular formula C24H37BO5 and a molecular weight of 416.37 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[4-[[4-[(2R)-oxan-2-yl]oxycyclohexyl]methoxy]phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[4-[[4-[(2R)-oxan-2-yl]oxycyclohexyl]methoxy]phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 125496612 |
| Molecular Formula | C24H37BO5 |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[4-[[4-[(2R)-oxan-2-yl]oxycyclohexyl]methoxy]phenyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(OCC3CCC(O[C@@H]4CCCCO4)CC3)cc2)OC1(C)C |
| InChI | InChI=1S/C24H37BO5/c1-23(2)24(3,4)30-25(29-23)19-10-14-20(15-11-19)27-17-18-8-12-21(13-9-18)28-22-7-5-6-16-26-22/h10-11,14-15,18,21-22H,5-9,12-13,16-17H2,1-4H3/t18?,21?,22-/m1/s1 |
| InChIKey | SMFTYTRLFIZIPU-FQUBMZHMSA-N |
| XLogP | 4.47 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|