C19H26BF3O4 — CID 99773337
4,4,5,5-tetramethyl-2-[3-[[(2S)-oxan-2-yl]methoxy]-5-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane (PubChem CID 99773337) has the molecular formula C19H26BF3O4 and a molecular weight of 386.22 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[3-[[(2S)-oxan-2-yl]methoxy]-5-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[3-[[(2S)-oxan-2-yl]methoxy]-5-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 99773337 |
| Molecular Formula | C19H26BF3O4 |
| Molecular Weight | 386.22 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[3-[[(2S)-oxan-2-yl]methoxy]-5-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cc(OC[C@@H]3CCCCO3)cc(C(F)(F)F)c2)OC1(C)C |
| InChI | InChI=1S/C19H26BF3O4/c1-17(2)18(3,4)27-20(26-17)14-9-13(19(21,22)23)10-16(11-14)25-12-15-7-5-6-8-24-15/h9-11,15H,5-8,12H2,1-4H3/t15-/m0/s1 |
| InChIKey | BMZHYBAXJQFTLD-HNNXBMFYSA-N |
| XLogP | 3.95 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.22 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|