C26H33BO7 — CID 154468061
2-[2-[[3-(oxolan-2-ylmethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]phenyl]acetic acid (PubChem CID 154468061) has the molecular formula C26H33BO7 and a molecular weight of 468.36 g/mol. Its IUPAC name is 2-[2-[[3-(oxolan-2-ylmethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]phenyl]acetic acid.
| Compound Name | 2-[2-[[3-(oxolan-2-ylmethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 154468061 |
| Molecular Formula | C26H33BO7 |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 2-[2-[[3-(oxolan-2-ylmethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]phenyl]acetic acid |
| SMILES | CC1(C)OB(c2cc(COc3ccccc3CC(=O)O)cc(OCC3CCCO3)c2)OC1(C)C |
| InChI | InChI=1S/C26H33BO7/c1-25(2)26(3,4)34-27(33-25)20-12-18(13-22(15-20)31-17-21-9-7-11-30-21)16-32-23-10-6-5-8-19(23)14-24(28)29/h5-6,8,10,12-13,15,21H,7,9,11,14,16-17H2,1-4H3,(H,28,29) |
| InChIKey | XEFPTQWYROFHGO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|