C31H45BO7 — CID 145093484
tert-butyl 2-[2-[[3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]phenyl]acetate;2-methyloxolane (PubChem CID 145093484) has the molecular formula C31H45BO7 and a molecular weight of 540.51 g/mol. Its IUPAC name is tert-butyl 2-[2-[[3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]phenyl]acetate;2-methyloxolane.
| Compound Name | tert-butyl 2-[2-[[3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]phenyl]acetate;2-methyloxolane |
|---|---|
| PubChem CID | 145093484 |
| Molecular Formula | C31H45BO7 |
| Molecular Weight | 540.51 g/mol |
| Exact Mass | 540.33 |
| IUPAC Name | tert-butyl 2-[2-[[3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]phenyl]acetate;2-methyloxolane |
| SMILES | CC1CCCO1.COc1cc(COc2ccccc2CC(=O)OC(C)(C)C)cc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C26H35BO6.C5H10O/c1-24(2,3)31-23(28)15-19-11-9-10-12-22(19)30-17-18-13-20(16-21(14-18)29-8)27-32-25(4,5)26(6,7)33-27;1-5-3-2-4-6-5/h9-14,16H,15,17H2,1-8H3;5H,2-4H2,1H3 |
| InChIKey | CHNCJRINXVCXFR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.51 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|