C20H23BrO3 — CID 121354476
tert-butyl 2-[2-[(3-bromo-5-methylphenyl)methoxy]phenyl]acetate (PubChem CID 121354476) has the molecular formula C20H23BrO3 and a molecular weight of 391.31 g/mol. Its IUPAC name is tert-butyl 2-[2-[(3-bromo-5-methylphenyl)methoxy]phenyl]acetate.
| Compound Name | tert-butyl 2-[2-[(3-bromo-5-methylphenyl)methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 121354476 |
| Molecular Formula | C20H23BrO3 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | tert-butyl 2-[2-[(3-bromo-5-methylphenyl)methoxy]phenyl]acetate |
| SMILES | Cc1cc(Br)cc(COc2ccccc2CC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C20H23BrO3/c1-14-9-15(11-17(21)10-14)13-23-18-8-6-5-7-16(18)12-19(22)24-20(2,3)4/h5-11H,12-13H2,1-4H3 |
| InChIKey | YKMNXSUODYLTCD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |