C15H12Br2O3 — CID 155588815
1-[2-[(3,5-dibromophenyl)methoxy]-6-hydroxyphenyl]ethanone (PubChem CID 155588815) has the molecular formula C15H12Br2O3 and a molecular weight of 400.07 g/mol. Its IUPAC name is 1-[2-[(3,5-dibromophenyl)methoxy]-6-hydroxyphenyl]ethanone.
| Compound Name | 1-[2-[(3,5-dibromophenyl)methoxy]-6-hydroxyphenyl]ethanone |
|---|---|
| PubChem CID | 155588815 |
| Molecular Formula | C15H12Br2O3 |
| Molecular Weight | 400.07 g/mol |
| Exact Mass | 397.92 |
| IUPAC Name | 1-[2-[(3,5-dibromophenyl)methoxy]-6-hydroxyphenyl]ethanone |
| SMILES | CC(=O)c1c(O)cccc1OCc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C15H12Br2O3/c1-9(18)15-13(19)3-2-4-14(15)20-8-10-5-11(16)7-12(17)6-10/h2-7,19H,8H2,1H3 |
| InChIKey | MBQYXLHWTJXKEK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.07 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |