C24H21BrO4 — CID 127047361
(E)-3-(5-bromo-2-ethoxyphenyl)-1-(2-hydroxy-6-phenylmethoxyphenyl)prop-2-en-1-one (PubChem CID 127047361) has the molecular formula C24H21BrO4 and a molecular weight of 453.33 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-ethoxyphenyl)-1-(2-hydroxy-6-phenylmethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(5-bromo-2-ethoxyphenyl)-1-(2-hydroxy-6-phenylmethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 127047361 |
| Molecular Formula | C24H21BrO4 |
| Molecular Weight | 453.33 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | (E)-3-(5-bromo-2-ethoxyphenyl)-1-(2-hydroxy-6-phenylmethoxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1ccc(Br)cc1/C=C/C(=O)c1c(O)cccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H21BrO4/c1-2-28-22-14-12-19(25)15-18(22)11-13-21(27)24-20(26)9-6-10-23(24)29-16-17-7-4-3-5-8-17/h3-15,26H,2,16H2,1H3/b13-11+ |
| InChIKey | WZDRZFYYAYZSJF-ACCUITESSA-N |
| XLogP | 6.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.33 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|