C17H19BrN2O2 — CID 19567639
(E)-3-(5-bromo-2-ethoxyphenyl)-1-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 19567639) has the molecular formula C17H19BrN2O2 and a molecular weight of 363.26 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-ethoxyphenyl)-1-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(5-bromo-2-ethoxyphenyl)-1-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19567639 |
| Molecular Formula | C17H19BrN2O2 |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | (E)-3-(5-bromo-2-ethoxyphenyl)-1-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | CCOc1ccc(Br)cc1/C=C/C(=O)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C17H19BrN2O2/c1-5-22-16-9-7-14(18)10-13(16)6-8-15(21)17-11(2)19-20(4)12(17)3/h6-10H,5H2,1-4H3/b8-6+ |
| InChIKey | KIVZALJUEZNQOR-SOFGYWHQSA-N |
| XLogP | 4.09 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|