C17H22BrNO2 — CID 19185267
(E)-3-(5-bromo-2-ethoxyphenyl)-1-(4-methylpiperidin-1-yl)prop-2-en-1-one (PubChem CID 19185267) has the molecular formula C17H22BrNO2 and a molecular weight of 352.27 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-ethoxyphenyl)-1-(4-methylpiperidin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(5-bromo-2-ethoxyphenyl)-1-(4-methylpiperidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19185267 |
| Molecular Formula | C17H22BrNO2 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | (E)-3-(5-bromo-2-ethoxyphenyl)-1-(4-methylpiperidin-1-yl)prop-2-en-1-one |
| SMILES | CCOc1ccc(Br)cc1/C=C/C(=O)N1CCC(C)CC1 |
| InChI | InChI=1S/C17H22BrNO2/c1-3-21-16-6-5-15(18)12-14(16)4-7-17(20)19-10-8-13(2)9-11-19/h4-7,12-13H,3,8-11H2,1-2H3/b7-4+ |
| InChIKey | UYTVITVTDCHXEV-QPJJXVBHSA-N |
| XLogP | 4.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|