C10H12O5 — CID 69072315
1-[2,6-bis(hydroxymethoxy)phenyl]ethanone (PubChem CID 69072315) has the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. Its IUPAC name is 1-[2,6-bis(hydroxymethoxy)phenyl]ethanone.
| Compound Name | 1-[2,6-bis(hydroxymethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 69072315 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 1-[2,6-bis(hydroxymethoxy)phenyl]ethanone |
| SMILES | CC(=O)c1c(OCO)cccc1OCO |
| InChI | InChI=1S/C10H12O5/c1-7(13)10-8(14-5-11)3-2-4-9(10)15-6-12/h2-4,11-12H,5-6H2,1H3 |
| InChIKey | PYIWGPMHXLRDLG-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|