C28H38BNO5 — CID 176508271
tert-butyl N-cyclopropyl-N-[[3-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate (PubChem CID 176508271) has the molecular formula C28H38BNO5 and a molecular weight of 479.43 g/mol. Its IUPAC name is tert-butyl N-cyclopropyl-N-[[3-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-cyclopropyl-N-[[3-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 176508271 |
| Molecular Formula | C28H38BNO5 |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | tert-butyl N-cyclopropyl-N-[[3-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1cc(OCc2ccccc2)cc(B2OC(C)(C)C(C)(C)O2)c1)C1CC1 |
| InChI | InChI=1S/C28H38BNO5/c1-26(2,3)33-25(31)30(23-13-14-23)18-21-15-22(29-34-27(4,5)28(6,7)35-29)17-24(16-21)32-19-20-11-9-8-10-12-20/h8-12,15-17,23H,13-14,18-19H2,1-7H3 |
| InChIKey | CRFUHLASQDAEJJ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|