C26H33NO4 — CID 176508313
tert-butyl N-[(3-ethenyl-5-phenylmethoxyphenyl)methyl]-N-(oxan-4-yl)carbamate (PubChem CID 176508313) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is tert-butyl N-[(3-ethenyl-5-phenylmethoxyphenyl)methyl]-N-(oxan-4-yl)carbamate.
| Compound Name | tert-butyl N-[(3-ethenyl-5-phenylmethoxyphenyl)methyl]-N-(oxan-4-yl)carbamate |
|---|---|
| PubChem CID | 176508313 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | tert-butyl N-[(3-ethenyl-5-phenylmethoxyphenyl)methyl]-N-(oxan-4-yl)carbamate |
| SMILES | C=Cc1cc(CN(C(=O)OC(C)(C)C)C2CCOCC2)cc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C26H33NO4/c1-5-20-15-22(17-24(16-20)30-19-21-9-7-6-8-10-21)18-27(23-11-13-29-14-12-23)25(28)31-26(2,3)4/h5-10,15-17,23H,1,11-14,18-19H2,2-4H3 |
| InChIKey | DGQGYMHAHKIXEH-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |