C21H26BrNO3 — CID 176508288
tert-butyl N-[(3-bromo-5-phenylmethoxyphenyl)methyl]-N-ethylcarbamate (PubChem CID 176508288) has the molecular formula C21H26BrNO3 and a molecular weight of 420.35 g/mol. Its IUPAC name is tert-butyl N-[(3-bromo-5-phenylmethoxyphenyl)methyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[(3-bromo-5-phenylmethoxyphenyl)methyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 176508288 |
| Molecular Formula | C21H26BrNO3 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | tert-butyl N-[(3-bromo-5-phenylmethoxyphenyl)methyl]-N-ethylcarbamate |
| SMILES | CCN(Cc1cc(Br)cc(OCc2ccccc2)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H26BrNO3/c1-5-23(20(24)26-21(2,3)4)14-17-11-18(22)13-19(12-17)25-15-16-9-7-6-8-10-16/h6-13H,5,14-15H2,1-4H3 |
| InChIKey | NXNWQLYVBRJPBE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |