C39H44BrNO6 — CID 159063353
2-bromo-1-(4-phenylmethoxyphenyl)ethanone;tert-butyl N-butyl-N-[2-oxo-2-(4-phenylmethoxyphenyl)ethyl]carbamate (PubChem CID 159063353) has the molecular formula C39H44BrNO6 and a molecular weight of 702.69 g/mol. Its IUPAC name is 2-bromo-1-(4-phenylmethoxyphenyl)ethanone;tert-butyl N-butyl-N-[2-oxo-2-(4-phenylmethoxyphenyl)ethyl]carbamate.
| Compound Name | 2-bromo-1-(4-phenylmethoxyphenyl)ethanone;tert-butyl N-butyl-N-[2-oxo-2-(4-phenylmethoxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 159063353 |
| Molecular Formula | C39H44BrNO6 |
| Molecular Weight | 702.69 g/mol |
| Exact Mass | 701.24 |
| IUPAC Name | 2-bromo-1-(4-phenylmethoxyphenyl)ethanone;tert-butyl N-butyl-N-[2-oxo-2-(4-phenylmethoxyphenyl)ethyl]carbamate |
| SMILES | CCCCN(CC(=O)c1ccc(OCc2ccccc2)cc1)C(=O)OC(C)(C)C.O=C(CBr)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H31NO4.C15H13BrO2/c1-5-6-16-25(23(27)29-24(2,3)4)17-22(26)20-12-14-21(15-13-20)28-18-19-10-8-7-9-11-19;16-10-15(17)13-6-8-14(9-7-13)18-11-12-4-2-1-3-5-12/h7-15H,5-6,16-18H2,1-4H3;1-9H,10-11H2 |
| InChIKey | JYTCLRALDWRFOK-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.69 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|