C21H25NO4 — CID 155069323
[2-oxo-2-(4-phenylmethoxyphenyl)ethyl]-[(2R)-pentan-2-yl]carbamic acid (PubChem CID 155069323) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylmethoxyphenyl)ethyl]-[(2R)-pentan-2-yl]carbamic acid.
| Compound Name | [2-oxo-2-(4-phenylmethoxyphenyl)ethyl]-[(2R)-pentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 155069323 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | [2-oxo-2-(4-phenylmethoxyphenyl)ethyl]-[(2R)-pentan-2-yl]carbamic acid |
| SMILES | CCC[C@@H](C)N(CC(=O)c1ccc(OCc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C21H25NO4/c1-3-7-16(2)22(21(24)25)14-20(23)18-10-12-19(13-11-18)26-15-17-8-5-4-6-9-17/h4-6,8-13,16H,3,7,14-15H2,1-2H3,(H,24,25)/t16-/m1/s1 |
| InChIKey | DFDHPPGRBLDWDH-MRXNPFEDSA-N |
| XLogP | 4.62 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |