C25H35NO6 — CID 168818010
tert-butyl N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-[(3-phenylmethoxyphenyl)methyl]carbamate (PubChem CID 168818010) has the molecular formula C25H35NO6 and a molecular weight of 445.56 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-[(3-phenylmethoxyphenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-[(3-phenylmethoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 168818010 |
| Molecular Formula | C25H35NO6 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | tert-butyl N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-[(3-phenylmethoxyphenyl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCOCCOCCO)Cc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C25H35NO6/c1-25(2,3)32-24(28)26(12-14-29-16-17-30-15-13-27)19-22-10-7-11-23(18-22)31-20-21-8-5-4-6-9-21/h4-11,18,27H,12-17,19-20H2,1-3H3 |
| InChIKey | VQPWHEDMJQNYOO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|