C16H24FNO4 — CID 18933288
tert-butyl N-[(4-fluorophenyl)methyl]-N-[2-(2-hydroxyethoxy)ethyl]carbamate (PubChem CID 18933288) has the molecular formula C16H24FNO4 and a molecular weight of 313.37 g/mol. Its IUPAC name is tert-butyl N-[(4-fluorophenyl)methyl]-N-[2-(2-hydroxyethoxy)ethyl]carbamate.
| Compound Name | tert-butyl N-[(4-fluorophenyl)methyl]-N-[2-(2-hydroxyethoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 18933288 |
| Molecular Formula | C16H24FNO4 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | tert-butyl N-[(4-fluorophenyl)methyl]-N-[2-(2-hydroxyethoxy)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCOCCO)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C16H24FNO4/c1-16(2,3)22-15(20)18(8-10-21-11-9-19)12-13-4-6-14(17)7-5-13/h4-7,19H,8-12H2,1-3H3 |
| InChIKey | GYOZJJQSUSMMOH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|