About 2-(2-hydroxyethoxy)ethanol;phenoxymethylbenzene
2-(2-hydroxyethoxy)ethanol;phenoxymethylbenzene (PubChem CID 174311801) has the molecular formula C17H22O4
and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethanol;phenoxymethylbenzene.
Molecular Properties
| Compound Name | 2-(2-hydroxyethoxy)ethanol;phenoxymethylbenzene |
| PubChem CID | 174311801 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethanol;phenoxymethylbenzene |
| SMILES | OCCOCCO.c1ccc(COc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12O.C4H10O3/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13;5-1-3-7-4-2-6/h1-10H,11H2;5-6H,1-4H2 |
| InChIKey | GHPMMZGPOGUISN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyethoxy)ethanol;phenoxymethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethoxy)ethanol;phenoxymethylbenzene?
The IUPAC name of 2-(2-hydroxyethoxy)ethanol;phenoxymethylbenzene (CID 174311801) is 2-(2-hydroxyethoxy)ethanol;phenoxymethylbenzene.
What is the SMILES notation for 2-(2-hydroxyethoxy)ethanol;phenoxymethylbenzene?
The canonical SMILES for 2-(2-hydroxyethoxy)ethanol;phenoxymethylbenzene is OCCOCCO.c1ccc(COc2ccccc2)cc1.
What is the InChIKey of 2-(2-hydroxyethoxy)ethanol;phenoxymethylbenzene?
The InChIKey is GHPMMZGPOGUISN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O.C4H10O3/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13;5-1-3-7-4-2-6/h1-10H,11H2;5-6H,1-4H2.
What are the key properties of 2-(2-hydroxyethoxy)ethanol;phenoxymethylbenzene?
2-(2-hydroxyethoxy)ethanol;phenoxymethylbenzene has a molecular weight of 290.36 g/mol, XLogP of 2.25, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethoxy)ethanol;phenoxymethylbenzene is sourced from PubChem (CID 174311801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).