C14H20F2O3 — CID 138693605
2-(3,3-difluoro-5-phenylmethoxypentoxy)ethanol (PubChem CID 138693605) has the molecular formula C14H20F2O3 and a molecular weight of 274.31 g/mol. Its IUPAC name is 2-(3,3-difluoro-5-phenylmethoxypentoxy)ethanol.
| Compound Name | 2-(3,3-difluoro-5-phenylmethoxypentoxy)ethanol |
|---|---|
| PubChem CID | 138693605 |
| Molecular Formula | C14H20F2O3 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-(3,3-difluoro-5-phenylmethoxypentoxy)ethanol |
| SMILES | OCCOCCC(F)(F)CCOCc1ccccc1 |
| InChI | InChI=1S/C14H20F2O3/c15-14(16,6-9-18-11-8-17)7-10-19-12-13-4-2-1-3-5-13/h1-5,17H,6-12H2 |
| InChIKey | NHRBAOVZNMJLJR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|