C14H21NO4 — CID 142731266
tert-butyl N-[(3,4-dihydroxyphenyl)methyl]-N-ethylcarbamate (PubChem CID 142731266) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is tert-butyl N-[(3,4-dihydroxyphenyl)methyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[(3,4-dihydroxyphenyl)methyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 142731266 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | tert-butyl N-[(3,4-dihydroxyphenyl)methyl]-N-ethylcarbamate |
| SMILES | CCN(Cc1ccc(O)c(O)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H21NO4/c1-5-15(13(18)19-14(2,3)4)9-10-6-7-11(16)12(17)8-10/h6-8,16-17H,5,9H2,1-4H3 |
| InChIKey | LLMFKCICSQFJSF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|